C11H12BrClF3N — CID 105024152
1-(4-bromo-3-chlorophenyl)-5,5,5-trifluoropentan-1-amine (PubChem CID 105024152) has the molecular formula C11H12BrClF3N and a molecular weight of 330.57 g/mol. Its IUPAC name is 1-(4-bromo-3-chlorophenyl)-5,5,5-trifluoropentan-1-amine.
| Compound Name | 1-(4-bromo-3-chlorophenyl)-5,5,5-trifluoropentan-1-amine |
|---|---|
| PubChem CID | 105024152 |
| Molecular Formula | C11H12BrClF3N |
| Molecular Weight | 330.57 g/mol |
| Exact Mass | 328.98 |
| IUPAC Name | 1-(4-bromo-3-chlorophenyl)-5,5,5-trifluoropentan-1-amine |
| SMILES | NC(CCCC(F)(F)F)c1ccc(Br)c(Cl)c1 |
| InChI | InChI=1S/C11H12BrClF3N/c12-8-4-3-7(6-9(8)13)10(17)2-1-5-11(14,15)16/h3-4,6,10H,1-2,5,17H2 |
| InChIKey | GEHCARQSBYGDCN-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.57 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |