C16H16F3N — CID 115803114
2-(4-ethylphenyl)-1-(2,3,4-trifluorophenyl)ethanamine (PubChem CID 115803114) has the molecular formula C16H16F3N and a molecular weight of 279.31 g/mol. Its IUPAC name is 2-(4-ethylphenyl)-1-(2,3,4-trifluorophenyl)ethanamine.
| Compound Name | 2-(4-ethylphenyl)-1-(2,3,4-trifluorophenyl)ethanamine |
|---|---|
| PubChem CID | 115803114 |
| Molecular Formula | C16H16F3N |
| Molecular Weight | 279.31 g/mol |
| Exact Mass | 279.12 |
| IUPAC Name | 2-(4-ethylphenyl)-1-(2,3,4-trifluorophenyl)ethanamine |
| SMILES | CCc1ccc(CC(N)c2ccc(F)c(F)c2F)cc1 |
| InChI | InChI=1S/C16H16F3N/c1-2-10-3-5-11(6-4-10)9-14(20)12-7-8-13(17)16(19)15(12)18/h3-8,14H,2,9,20H2,1H3 |
| InChIKey | LMVCMKDQUNDCOT-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.31 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|