C13H20F2N2O — CID 114059481
2-[[3-amino-3-(2,3-difluorophenyl)propyl]-ethylamino]ethanol (PubChem CID 114059481) has the molecular formula C13H20F2N2O and a molecular weight of 258.31 g/mol. Its IUPAC name is 2-[[3-amino-3-(2,3-difluorophenyl)propyl]-ethylamino]ethanol.
| Compound Name | 2-[[3-amino-3-(2,3-difluorophenyl)propyl]-ethylamino]ethanol |
|---|---|
| PubChem CID | 114059481 |
| Molecular Formula | C13H20F2N2O |
| Molecular Weight | 258.31 g/mol |
| Exact Mass | 258.15 |
| IUPAC Name | 2-[[3-amino-3-(2,3-difluorophenyl)propyl]-ethylamino]ethanol |
| SMILES | CCN(CCO)CCC(N)c1cccc(F)c1F |
| InChI | InChI=1S/C13H20F2N2O/c1-2-17(8-9-18)7-6-12(16)10-4-3-5-11(14)13(10)15/h3-5,12,18H,2,6-9,16H2,1H3 |
| InChIKey | RKIBQFXMFFRPOL-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.31 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |