C22H24FN3O5 — CID 162374918
tert-butyl N-[(2S)-2-[[3-[(1,3-dioxoisoindol-2-yl)methyl]-5-fluoro-2-pyridinyl]oxy]propyl]carbamate (PubChem CID 162374918) has the molecular formula C22H24FN3O5 and a molecular weight of 429.45 g/mol. Its IUPAC name is tert-butyl N-[(2S)-2-[[3-[(1,3-dioxoisoindol-2-yl)methyl]-5-fluoro-2-pyridinyl]oxy]propyl]carbamate.
| Compound Name | tert-butyl N-[(2S)-2-[[3-[(1,3-dioxoisoindol-2-yl)methyl]-5-fluoro-2-pyridinyl]oxy]propyl]carbamate |
|---|---|
| PubChem CID | 162374918 |
| Molecular Formula | C22H24FN3O5 |
| Molecular Weight | 429.45 g/mol |
| Exact Mass | 429.17 |
| IUPAC Name | tert-butyl N-[(2S)-2-[[3-[(1,3-dioxoisoindol-2-yl)methyl]-5-fluoro-2-pyridinyl]oxy]propyl]carbamate |
| SMILES | C[C@@H](CNC(=O)OC(C)(C)C)Oc1ncc(F)cc1CN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C22H24FN3O5/c1-13(10-25-21(29)31-22(2,3)4)30-18-14(9-15(23)11-24-18)12-26-19(27)16-7-5-6-8-17(16)20(26)28/h5-9,11,13H,10,12H2,1-4H3,(H,25,29)/t13-/m0/s1 |
| InChIKey | LIGNJSDZUJQJRI-ZDUSSCGKSA-N |
| XLogP | 3.31 |
| TPSA | 97.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.45 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|