C24H33N3OS2 — CID 11316712
5-(dithiolan-3-yl)-N-[3-(1,2,3,4-tetrahydroacridin-9-ylamino)propyl]pentanamide (PubChem CID 11316712) has the molecular formula C24H33N3OS2 and a molecular weight of 443.68 g/mol. Its IUPAC name is 5-(dithiolan-3-yl)-N-[3-(1,2,3,4-tetrahydroacridin-9-ylamino)propyl]pentanamide.
| Compound Name | 5-(dithiolan-3-yl)-N-[3-(1,2,3,4-tetrahydroacridin-9-ylamino)propyl]pentanamide |
|---|---|
| PubChem CID | 11316712 |
| Molecular Formula | C24H33N3OS2 |
| Molecular Weight | 443.68 g/mol |
| Exact Mass | 443.21 |
| IUPAC Name | 5-(dithiolan-3-yl)-N-[3-(1,2,3,4-tetrahydroacridin-9-ylamino)propyl]pentanamide |
| SMILES | O=C(CCCCC1CCSS1)NCCCNc1c2c(nc3ccccc13)CCCC2 |
| InChI | InChI=1S/C24H33N3OS2/c28-23(13-6-1-8-18-14-17-29-30-18)25-15-7-16-26-24-19-9-2-4-11-21(19)27-22-12-5-3-10-20(22)24/h2,4,9,11,18H,1,3,5-8,10,12-17H2,(H,25,28)(H,26,27) |
| InChIKey | FUZSKXNTSYMEMF-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.68 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|