C17H18N2 — CID 101166036
N-but-3-ynyl-1,2,3,4-tetrahydroacridin-9-amine (PubChem CID 101166036) has the molecular formula C17H18N2 and a molecular weight of 250.34 g/mol. Its IUPAC name is N-but-3-ynyl-1,2,3,4-tetrahydroacridin-9-amine.
| Compound Name | N-but-3-ynyl-1,2,3,4-tetrahydroacridin-9-amine |
|---|---|
| PubChem CID | 101166036 |
| Molecular Formula | C17H18N2 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.15 |
| IUPAC Name | N-but-3-ynyl-1,2,3,4-tetrahydroacridin-9-amine |
| SMILES | C#CCCNc1c2c(nc3ccccc13)CCCC2 |
| InChI | InChI=1S/C17H18N2/c1-2-3-12-18-17-13-8-4-6-10-15(13)19-16-11-7-5-9-14(16)17/h1,4,6,8,10H,3,5,7,9,11-12H2,(H,18,19) |
| InChIKey | RJRXHEAALLXCSI-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|