C19H26N3O2+ — CID 7138238
4-[(7-carboxy-2,3-dihydro-1H-cyclopenta[b]quinolin-9-yl)amino]butyl-dimethylazanium (PubChem CID 7138238) has the molecular formula C19H26N3O2+ and a molecular weight of 328.44 g/mol. Its IUPAC name is 4-[(7-carboxy-2,3-dihydro-1H-cyclopenta[b]quinolin-9-yl)amino]butyl-dimethylazanium.
| Compound Name | 4-[(7-carboxy-2,3-dihydro-1H-cyclopenta[b]quinolin-9-yl)amino]butyl-dimethylazanium |
|---|---|
| PubChem CID | 7138238 |
| Molecular Formula | C19H26N3O2+ |
| Molecular Weight | 328.44 g/mol |
| Exact Mass | 328.20 |
| IUPAC Name | 4-[(7-carboxy-2,3-dihydro-1H-cyclopenta[b]quinolin-9-yl)amino]butyl-dimethylazanium |
| SMILES | C[NH+](C)CCCCNc1c2c(nc3ccc(C(=O)O)cc13)CCC2 |
| InChI | InChI=1S/C19H25N3O2/c1-22(2)11-4-3-10-20-18-14-6-5-7-16(14)21-17-9-8-13(19(23)24)12-15(17)18/h8-9,12H,3-7,10-11H2,1-2H3,(H,20,21)(H,23,24)/p+1 |
| InChIKey | SYKMBJCMPJKYQU-UHFFFAOYSA-O |
| XLogP | 1.76 |
| TPSA | 66.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.44 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|