C19H25ClN2 — CID 87257292
6-chloro-N-(6-deuteriohexyl)-1,2,3,4-tetrahydroacridin-9-amine (PubChem CID 87257292) has the molecular formula C19H25ClN2 and a molecular weight of 317.88 g/mol. Its IUPAC name is 6-chloro-N-(6-deuteriohexyl)-1,2,3,4-tetrahydroacridin-9-amine.
| Compound Name | 6-chloro-N-(6-deuteriohexyl)-1,2,3,4-tetrahydroacridin-9-amine |
|---|---|
| PubChem CID | 87257292 |
| Molecular Formula | C19H25ClN2 |
| Molecular Weight | 317.88 g/mol |
| Exact Mass | 317.18 |
| IUPAC Name | 6-chloro-N-(6-deuteriohexyl)-1,2,3,4-tetrahydroacridin-9-amine |
| SMILES | [2H]CCCCCCNc1c2c(nc3cc(Cl)ccc13)CCCC2 |
| InChI | InChI=1S/C19H25ClN2/c1-2-3-4-7-12-21-19-15-8-5-6-9-17(15)22-18-13-14(20)10-11-16(18)19/h10-11,13H,2-9,12H2,1H3,(H,21,22)/i1D |
| InChIKey | VFHIEHHHYFSTIU-MICDWDOJSA-N |
| XLogP | 5.76 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.88 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|