C30H39ClN4O — CID 68985147
6-[8-[(6-chloro-1,2,3,4-tetrahydroacridin-9-yl)amino]octylamino]-5,6,7,8-tetrahydro-1H-quinolin-2-one (PubChem CID 68985147) has the molecular formula C30H39ClN4O and a molecular weight of 507.12 g/mol. Its IUPAC name is 6-[8-[(6-chloro-1,2,3,4-tetrahydroacridin-9-yl)amino]octylamino]-5,6,7,8-tetrahydro-1H-quinolin-2-one.
| Compound Name | 6-[8-[(6-chloro-1,2,3,4-tetrahydroacridin-9-yl)amino]octylamino]-5,6,7,8-tetrahydro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 68985147 |
| Molecular Formula | C30H39ClN4O |
| Molecular Weight | 507.12 g/mol |
| Exact Mass | 506.28 |
| IUPAC Name | 6-[8-[(6-chloro-1,2,3,4-tetrahydroacridin-9-yl)amino]octylamino]-5,6,7,8-tetrahydro-1H-quinolin-2-one |
| SMILES | O=c1ccc2c([nH]1)CCC(NCCCCCCCCNc1c3c(nc4cc(Cl)ccc14)CCCC3)C2 |
| InChI | InChI=1S/C30H39ClN4O/c31-22-12-14-25-28(20-22)34-27-10-6-5-9-24(27)30(25)33-18-8-4-2-1-3-7-17-32-23-13-15-26-21(19-23)11-16-29(36)35-26/h11-12,14,16,20,23,32H,1-10,13,15,17-19H2,(H,33,34)(H,35,36) |
| InChIKey | MJGWIGHIQLEJMP-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 69.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.12 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|