C32H43ClN4O — CID 68980489
5-[10-[(6-chloro-1,2,3,4-tetrahydroacridin-9-yl)amino]decylamino]-5,6,7,8-tetrahydro-1H-quinolin-2-one (PubChem CID 68980489) has the molecular formula C32H43ClN4O and a molecular weight of 535.18 g/mol. Its IUPAC name is 5-[10-[(6-chloro-1,2,3,4-tetrahydroacridin-9-yl)amino]decylamino]-5,6,7,8-tetrahydro-1H-quinolin-2-one.
| Compound Name | 5-[10-[(6-chloro-1,2,3,4-tetrahydroacridin-9-yl)amino]decylamino]-5,6,7,8-tetrahydro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 68980489 |
| Molecular Formula | C32H43ClN4O |
| Molecular Weight | 535.18 g/mol |
| Exact Mass | 534.31 |
| IUPAC Name | 5-[10-[(6-chloro-1,2,3,4-tetrahydroacridin-9-yl)amino]decylamino]-5,6,7,8-tetrahydro-1H-quinolin-2-one |
| SMILES | O=c1ccc2c([nH]1)CCCC2NCCCCCCCCCCNc1c2c(nc3cc(Cl)ccc13)CCCC2 |
| InChI | InChI=1S/C32H43ClN4O/c33-23-16-17-26-30(22-23)36-29-13-8-7-12-25(29)32(26)35-21-10-6-4-2-1-3-5-9-20-34-27-14-11-15-28-24(27)18-19-31(38)37-28/h16-19,22,27,34H,1-15,20-21H2,(H,35,36)(H,37,38) |
| InChIKey | NZNBPRGOJIVKFV-UHFFFAOYSA-N |
| XLogP | 7.66 |
| TPSA | 69.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.18 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|