C32H39ClN4O2 — CID 123912836
1H-indol-5-yl N-[10-[(7-chloro-1,2,3,4-tetrahydroacridin-9-yl)amino]decyl]carbamate (PubChem CID 123912836) has the molecular formula C32H39ClN4O2 and a molecular weight of 547.14 g/mol. Its IUPAC name is 1H-indol-5-yl N-[10-[(7-chloro-1,2,3,4-tetrahydroacridin-9-yl)amino]decyl]carbamate.
| Compound Name | 1H-indol-5-yl N-[10-[(7-chloro-1,2,3,4-tetrahydroacridin-9-yl)amino]decyl]carbamate |
|---|---|
| PubChem CID | 123912836 |
| Molecular Formula | C32H39ClN4O2 |
| Molecular Weight | 547.14 g/mol |
| Exact Mass | 546.28 |
| IUPAC Name | 1H-indol-5-yl N-[10-[(7-chloro-1,2,3,4-tetrahydroacridin-9-yl)amino]decyl]carbamate |
| SMILES | O=C(NCCCCCCCCCCNc1c2c(nc3ccc(Cl)cc13)CCCC2)Oc1ccc2[nH]ccc2c1 |
| InChI | InChI=1S/C32H39ClN4O2/c33-24-13-15-30-27(22-24)31(26-11-7-8-12-29(26)37-30)35-18-9-5-3-1-2-4-6-10-19-36-32(38)39-25-14-16-28-23(21-25)17-20-34-28/h13-17,20-22,34H,1-12,18-19H2,(H,35,37)(H,36,38) |
| InChIKey | YKEZUUBQRQGAGI-UHFFFAOYSA-N |
| XLogP | 8.57 |
| TPSA | 79.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.14 |
| LogP ≤ 5 | 8.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|