C27H34N4O2 — CID 177380783
[3-[(1S)-1-(dimethylamino)ethyl]phenyl] N-[3-(1,2,3,4-tetrahydroacridin-9-ylamino)propyl]carbamate (PubChem CID 177380783) has the molecular formula C27H34N4O2 and a molecular weight of 446.60 g/mol. Its IUPAC name is [3-[(1S)-1-(dimethylamino)ethyl]phenyl] N-[3-(1,2,3,4-tetrahydroacridin-9-ylamino)propyl]carbamate.
| Compound Name | [3-[(1S)-1-(dimethylamino)ethyl]phenyl] N-[3-(1,2,3,4-tetrahydroacridin-9-ylamino)propyl]carbamate |
|---|---|
| PubChem CID | 177380783 |
| Molecular Formula | C27H34N4O2 |
| Molecular Weight | 446.60 g/mol |
| Exact Mass | 446.27 |
| IUPAC Name | [3-[(1S)-1-(dimethylamino)ethyl]phenyl] N-[3-(1,2,3,4-tetrahydroacridin-9-ylamino)propyl]carbamate |
| SMILES | C[C@@H](c1cccc(OC(=O)NCCCNc2c3c(nc4ccccc24)CCCC3)c1)N(C)C |
| InChI | InChI=1S/C27H34N4O2/c1-19(31(2)3)20-10-8-11-21(18-20)33-27(32)29-17-9-16-28-26-22-12-4-6-14-24(22)30-25-15-7-5-13-23(25)26/h4,6,8,10-12,14,18-19H,5,7,9,13,15-17H2,1-3H3,(H,28,30)(H,29,32)/t19-/m0/s1 |
| InChIKey | CFSVOXAPXLGZJI-IBGZPJMESA-N |
| XLogP | 5.33 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.60 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|