C29H27N5O2 — CID 177380804
[4-(1H-pyrrolo[2,3-b]pyridin-2-yl)phenyl] N-[2-(1,2,3,4-tetrahydroacridin-9-ylamino)ethyl]carbamate (PubChem CID 177380804) has the molecular formula C29H27N5O2 and a molecular weight of 477.57 g/mol. Its IUPAC name is [4-(1H-pyrrolo[2,3-b]pyridin-2-yl)phenyl] N-[2-(1,2,3,4-tetrahydroacridin-9-ylamino)ethyl]carbamate.
| Compound Name | [4-(1H-pyrrolo[2,3-b]pyridin-2-yl)phenyl] N-[2-(1,2,3,4-tetrahydroacridin-9-ylamino)ethyl]carbamate |
|---|---|
| PubChem CID | 177380804 |
| Molecular Formula | C29H27N5O2 |
| Molecular Weight | 477.57 g/mol |
| Exact Mass | 477.22 |
| IUPAC Name | [4-(1H-pyrrolo[2,3-b]pyridin-2-yl)phenyl] N-[2-(1,2,3,4-tetrahydroacridin-9-ylamino)ethyl]carbamate |
| SMILES | O=C(NCCNc1c2c(nc3ccccc13)CCCC2)Oc1ccc(-c2cc3cccnc3[nH]2)cc1 |
| InChI | InChI=1S/C29H27N5O2/c35-29(36-21-13-11-19(12-14-21)26-18-20-6-5-15-31-28(20)34-26)32-17-16-30-27-22-7-1-3-9-24(22)33-25-10-4-2-8-23(25)27/h1,3,5-7,9,11-15,18H,2,4,8,10,16-17H2,(H,30,33)(H,31,34)(H,32,35) |
| InChIKey | SVEUUKFTMQGKNW-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 91.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.57 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|