C22H25N5O2 — CID 155666121
ethyl 2-[2-(1,2,3,4-tetrahydroacridin-9-ylamino)ethylamino]pyrimidine-5-carboxylate (PubChem CID 155666121) has the molecular formula C22H25N5O2 and a molecular weight of 391.48 g/mol. Its IUPAC name is ethyl 2-[2-(1,2,3,4-tetrahydroacridin-9-ylamino)ethylamino]pyrimidine-5-carboxylate.
| Compound Name | ethyl 2-[2-(1,2,3,4-tetrahydroacridin-9-ylamino)ethylamino]pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 155666121 |
| Molecular Formula | C22H25N5O2 |
| Molecular Weight | 391.48 g/mol |
| Exact Mass | 391.20 |
| IUPAC Name | ethyl 2-[2-(1,2,3,4-tetrahydroacridin-9-ylamino)ethylamino]pyrimidine-5-carboxylate |
| SMILES | CCOC(=O)c1cnc(NCCNc2c3c(nc4ccccc24)CCCC3)nc1 |
| InChI | InChI=1S/C22H25N5O2/c1-2-29-21(28)15-13-25-22(26-14-15)24-12-11-23-20-16-7-3-5-9-18(16)27-19-10-6-4-8-17(19)20/h3,5,7,9,13-14H,2,4,6,8,10-12H2,1H3,(H,23,27)(H,24,25,26) |
| InChIKey | SBHRTAGPEGNYDH-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 89.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.48 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|