C28H39N3O3 — CID 170458897
ethyl (E)-3-hydroxy-2-[8-(1,2,3,4-tetrahydroacridin-9-ylamino)octyliminomethyl]but-2-enoate (PubChem CID 170458897) has the molecular formula C28H39N3O3 and a molecular weight of 465.64 g/mol. Its IUPAC name is ethyl (E)-3-hydroxy-2-[8-(1,2,3,4-tetrahydroacridin-9-ylamino)octyliminomethyl]but-2-enoate.
| Compound Name | ethyl (E)-3-hydroxy-2-[8-(1,2,3,4-tetrahydroacridin-9-ylamino)octyliminomethyl]but-2-enoate |
|---|---|
| PubChem CID | 170458897 |
| Molecular Formula | C28H39N3O3 |
| Molecular Weight | 465.64 g/mol |
| Exact Mass | 465.30 |
| IUPAC Name | ethyl (E)-3-hydroxy-2-[8-(1,2,3,4-tetrahydroacridin-9-ylamino)octyliminomethyl]but-2-enoate |
| SMILES | CCOC(=O)C(/C=N/CCCCCCCCNc1c2c(nc3ccccc13)CCCC2)=C(\C)O |
| InChI | InChI=1S/C28H39N3O3/c1-3-34-28(33)24(21(2)32)20-29-18-12-6-4-5-7-13-19-30-27-22-14-8-10-16-25(22)31-26-17-11-9-15-23(26)27/h8,10,14,16,20,32H,3-7,9,11-13,15,17-19H2,1-2H3,(H,30,31)/b24-21+,29-20+ |
| InChIKey | QVZIQJHLKDABSO-GRQHAVTCSA-N |
| XLogP | 6.33 |
| TPSA | 83.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.64 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|