C27H31N5O2 — CID 123579665
[3-[2-(ethylamino)ethyl]-1H-indol-5-yl] N-[(1,2,3,4-tetrahydroacridin-9-ylamino)methyl]carbamate (PubChem CID 123579665) has the molecular formula C27H31N5O2 and a molecular weight of 457.58 g/mol. Its IUPAC name is [3-[2-(ethylamino)ethyl]-1H-indol-5-yl] N-[(1,2,3,4-tetrahydroacridin-9-ylamino)methyl]carbamate.
| Compound Name | [3-[2-(ethylamino)ethyl]-1H-indol-5-yl] N-[(1,2,3,4-tetrahydroacridin-9-ylamino)methyl]carbamate |
|---|---|
| PubChem CID | 123579665 |
| Molecular Formula | C27H31N5O2 |
| Molecular Weight | 457.58 g/mol |
| Exact Mass | 457.25 |
| IUPAC Name | [3-[2-(ethylamino)ethyl]-1H-indol-5-yl] N-[(1,2,3,4-tetrahydroacridin-9-ylamino)methyl]carbamate |
| SMILES | CCNCCc1c[nH]c2ccc(OC(=O)NCNc3c4c(nc5ccccc35)CCCC4)cc12 |
| InChI | InChI=1S/C27H31N5O2/c1-2-28-14-13-18-16-29-23-12-11-19(15-22(18)23)34-27(33)31-17-30-26-20-7-3-5-9-24(20)32-25-10-6-4-8-21(25)26/h3,5,7,9,11-12,15-16,28-29H,2,4,6,8,10,13-14,17H2,1H3,(H,30,32)(H,31,33) |
| InChIKey | ZLVNSKHMYXPDDS-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 91.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.58 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|