C13H11Cl2NS — CID 82451652
(6,8-dichloro-2,3-dihydro-1H-cyclopenta[b]quinolin-9-yl)methanethiol (PubChem CID 82451652) has the molecular formula C13H11Cl2NS and a molecular weight of 284.21 g/mol. Its IUPAC name is (6,8-dichloro-2,3-dihydro-1H-cyclopenta[b]quinolin-9-yl)methanethiol.
| Compound Name | (6,8-dichloro-2,3-dihydro-1H-cyclopenta[b]quinolin-9-yl)methanethiol |
|---|---|
| PubChem CID | 82451652 |
| Molecular Formula | C13H11Cl2NS |
| Molecular Weight | 284.21 g/mol |
| Exact Mass | 283.00 |
| IUPAC Name | (6,8-dichloro-2,3-dihydro-1H-cyclopenta[b]quinolin-9-yl)methanethiol |
| SMILES | SCc1c2c(nc3cc(Cl)cc(Cl)c13)CCC2 |
| InChI | InChI=1S/C13H11Cl2NS/c14-7-4-10(15)13-9(6-17)8-2-1-3-11(8)16-12(13)5-7/h4-5,17H,1-3,6H2 |
| InChIKey | IXQJEAFFKOJSSI-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 12.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.21 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|