C12H11Cl2N3O — CID 106473710
(7,9-dichloro-3,4-dihydro-1H-pyrano[4,3-b]quinolin-10-yl)hydrazine (PubChem CID 106473710) has the molecular formula C12H11Cl2N3O and a molecular weight of 284.15 g/mol. Its IUPAC name is (7,9-dichloro-3,4-dihydro-1H-pyrano[4,3-b]quinolin-10-yl)hydrazine.
| Compound Name | (7,9-dichloro-3,4-dihydro-1H-pyrano[4,3-b]quinolin-10-yl)hydrazine |
|---|---|
| PubChem CID | 106473710 |
| Molecular Formula | C12H11Cl2N3O |
| Molecular Weight | 284.15 g/mol |
| Exact Mass | 283.03 |
| IUPAC Name | (7,9-dichloro-3,4-dihydro-1H-pyrano[4,3-b]quinolin-10-yl)hydrazine |
| SMILES | NNc1c2c(nc3cc(Cl)cc(Cl)c13)CCOC2 |
| InChI | InChI=1S/C12H11Cl2N3O/c13-6-3-8(14)11-10(4-6)16-9-1-2-18-5-7(9)12(11)17-15/h3-4H,1-2,5,15H2,(H,16,17) |
| InChIKey | MLXCNWGBKGFQIT-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.15 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|