C14H14Cl2FN3 — CID 107579086
(1,3-dichloro-2-fluoro-7,8,9,10-tetrahydro-6H-cyclohepta[b]quinolin-11-yl)hydrazine (PubChem CID 107579086) has the molecular formula C14H14Cl2FN3 and a molecular weight of 314.19 g/mol. Its IUPAC name is (1,3-dichloro-2-fluoro-7,8,9,10-tetrahydro-6H-cyclohepta[b]quinolin-11-yl)hydrazine.
| Compound Name | (1,3-dichloro-2-fluoro-7,8,9,10-tetrahydro-6H-cyclohepta[b]quinolin-11-yl)hydrazine |
|---|---|
| PubChem CID | 107579086 |
| Molecular Formula | C14H14Cl2FN3 |
| Molecular Weight | 314.19 g/mol |
| Exact Mass | 313.05 |
| IUPAC Name | (1,3-dichloro-2-fluoro-7,8,9,10-tetrahydro-6H-cyclohepta[b]quinolin-11-yl)hydrazine |
| SMILES | NNc1c2c(nc3cc(Cl)c(F)c(Cl)c13)CCCCC2 |
| InChI | InChI=1S/C14H14Cl2FN3/c15-8-6-10-11(12(16)13(8)17)14(20-18)7-4-2-1-3-5-9(7)19-10/h6H,1-5,18H2,(H,19,20) |
| InChIKey | VKEVIULHMYKQIQ-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.19 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|