C14H15ClIN3 — CID 107607966
(4-chloro-2-iodo-7,8,9,10-tetrahydro-6H-cyclohepta[b]quinolin-11-yl)hydrazine (PubChem CID 107607966) has the molecular formula C14H15ClIN3 and a molecular weight of 387.65 g/mol. Its IUPAC name is (4-chloro-2-iodo-7,8,9,10-tetrahydro-6H-cyclohepta[b]quinolin-11-yl)hydrazine.
| Compound Name | (4-chloro-2-iodo-7,8,9,10-tetrahydro-6H-cyclohepta[b]quinolin-11-yl)hydrazine |
|---|---|
| PubChem CID | 107607966 |
| Molecular Formula | C14H15ClIN3 |
| Molecular Weight | 387.65 g/mol |
| Exact Mass | 387.00 |
| IUPAC Name | (4-chloro-2-iodo-7,8,9,10-tetrahydro-6H-cyclohepta[b]quinolin-11-yl)hydrazine |
| SMILES | NNc1c2c(nc3c(Cl)cc(I)cc13)CCCCC2 |
| InChI | InChI=1S/C14H15ClIN3/c15-11-7-8(16)6-10-13(19-17)9-4-2-1-3-5-12(9)18-14(10)11/h6-7H,1-5,17H2,(H,18,19) |
| InChIKey | ZLGWISXAEKPYPV-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.65 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|