C14H16FN3 — CID 62251732
(6-fluoro-5-methyl-1,2,3,4-tetrahydroacridin-9-yl)hydrazine (PubChem CID 62251732) has the molecular formula C14H16FN3 and a molecular weight of 245.30 g/mol. Its IUPAC name is (6-fluoro-5-methyl-1,2,3,4-tetrahydroacridin-9-yl)hydrazine.
| Compound Name | (6-fluoro-5-methyl-1,2,3,4-tetrahydroacridin-9-yl)hydrazine |
|---|---|
| PubChem CID | 62251732 |
| Molecular Formula | C14H16FN3 |
| Molecular Weight | 245.30 g/mol |
| Exact Mass | 245.13 |
| IUPAC Name | (6-fluoro-5-methyl-1,2,3,4-tetrahydroacridin-9-yl)hydrazine |
| SMILES | Cc1c(F)ccc2c(NN)c3c(nc12)CCCC3 |
| InChI | InChI=1S/C14H16FN3/c1-8-11(15)7-6-10-13(8)17-12-5-3-2-4-9(12)14(10)18-16/h6-7H,2-5,16H2,1H3,(H,17,18) |
| InChIKey | OLWZBXIDSAKYJZ-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.30 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|