C15H19N3 — CID 62250780
(6,8-dimethyl-1,2,3,4-tetrahydroacridin-9-yl)hydrazine (PubChem CID 62250780) has the molecular formula C15H19N3 and a molecular weight of 241.34 g/mol. Its IUPAC name is (6,8-dimethyl-1,2,3,4-tetrahydroacridin-9-yl)hydrazine.
| Compound Name | (6,8-dimethyl-1,2,3,4-tetrahydroacridin-9-yl)hydrazine |
|---|---|
| PubChem CID | 62250780 |
| Molecular Formula | C15H19N3 |
| Molecular Weight | 241.34 g/mol |
| Exact Mass | 241.16 |
| IUPAC Name | (6,8-dimethyl-1,2,3,4-tetrahydroacridin-9-yl)hydrazine |
| SMILES | Cc1cc(C)c2c(NN)c3c(nc2c1)CCCC3 |
| InChI | InChI=1S/C15H19N3/c1-9-7-10(2)14-13(8-9)17-12-6-4-3-5-11(12)15(14)18-16/h7-8H,3-6,16H2,1-2H3,(H,17,18) |
| InChIKey | GMLFVIGOCMUQJV-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.34 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|