C15H16N2S — CID 82450847
6,8-dimethyl-2,3-dihydro-1H-cyclopenta[b]quinoline-9-carbothioamide (PubChem CID 82450847) has the molecular formula C15H16N2S and a molecular weight of 256.37 g/mol. Its IUPAC name is 6,8-dimethyl-2,3-dihydro-1H-cyclopenta[b]quinoline-9-carbothioamide.
| Compound Name | 6,8-dimethyl-2,3-dihydro-1H-cyclopenta[b]quinoline-9-carbothioamide |
|---|---|
| PubChem CID | 82450847 |
| Molecular Formula | C15H16N2S |
| Molecular Weight | 256.37 g/mol |
| Exact Mass | 256.10 |
| IUPAC Name | 6,8-dimethyl-2,3-dihydro-1H-cyclopenta[b]quinoline-9-carbothioamide |
| SMILES | Cc1cc(C)c2c(C(N)=S)c3c(nc2c1)CCC3 |
| InChI | InChI=1S/C15H16N2S/c1-8-6-9(2)13-12(7-8)17-11-5-3-4-10(11)14(13)15(16)18/h6-7H,3-5H2,1-2H3,(H2,16,18) |
| InChIKey | DWSDNOILSGRUQU-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.37 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|