C15H17N3 — CID 82450740
5,7-dimethyl-2,3-dihydro-1H-cyclopenta[b]quinoline-9-carboximidamide (PubChem CID 82450740) has the molecular formula C15H17N3 and a molecular weight of 239.32 g/mol. Its IUPAC name is 5,7-dimethyl-2,3-dihydro-1H-cyclopenta[b]quinoline-9-carboximidamide.
| Compound Name | 5,7-dimethyl-2,3-dihydro-1H-cyclopenta[b]quinoline-9-carboximidamide |
|---|---|
| PubChem CID | 82450740 |
| Molecular Formula | C15H17N3 |
| Molecular Weight | 239.32 g/mol |
| Exact Mass | 239.14 |
| IUPAC Name | 5,7-dimethyl-2,3-dihydro-1H-cyclopenta[b]quinoline-9-carboximidamide |
| SMILES | [H]/N=C(\N)c1c2c(nc3c(C)cc(C)cc13)CCC2 |
| InChI | InChI=1S/C15H17N3/c1-8-6-9(2)14-11(7-8)13(15(16)17)10-4-3-5-12(10)18-14/h6-7H,3-5H2,1-2H3,(H3,16,17) |
| InChIKey | CQCAZIDINQZXCG-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 62.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.32 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|