C14H14ClN3O — CID 82451849
7-chloro-5-methyl-2,3-dihydro-1H-cyclopenta[b]quinoline-9-carbohydrazide (PubChem CID 82451849) has the molecular formula C14H14ClN3O and a molecular weight of 275.74 g/mol. Its IUPAC name is 7-chloro-5-methyl-2,3-dihydro-1H-cyclopenta[b]quinoline-9-carbohydrazide.
| Compound Name | 7-chloro-5-methyl-2,3-dihydro-1H-cyclopenta[b]quinoline-9-carbohydrazide |
|---|---|
| PubChem CID | 82451849 |
| Molecular Formula | C14H14ClN3O |
| Molecular Weight | 275.74 g/mol |
| Exact Mass | 275.08 |
| IUPAC Name | 7-chloro-5-methyl-2,3-dihydro-1H-cyclopenta[b]quinoline-9-carbohydrazide |
| SMILES | Cc1cc(Cl)cc2c(C(=O)NN)c3c(nc12)CCC3 |
| InChI | InChI=1S/C14H14ClN3O/c1-7-5-8(15)6-10-12(14(19)18-16)9-3-2-4-11(9)17-13(7)10/h5-6H,2-4,16H2,1H3,(H,18,19) |
| InChIKey | KOLPVGYYDDMMSG-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.74 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|