C17H21N3O — CID 82450585
7-propan-2-yl-1,2,3,4-tetrahydroacridine-9-carbohydrazide (PubChem CID 82450585) has the molecular formula C17H21N3O and a molecular weight of 283.38 g/mol. Its IUPAC name is 7-propan-2-yl-1,2,3,4-tetrahydroacridine-9-carbohydrazide.
| Compound Name | 7-propan-2-yl-1,2,3,4-tetrahydroacridine-9-carbohydrazide |
|---|---|
| PubChem CID | 82450585 |
| Molecular Formula | C17H21N3O |
| Molecular Weight | 283.38 g/mol |
| Exact Mass | 283.17 |
| IUPAC Name | 7-propan-2-yl-1,2,3,4-tetrahydroacridine-9-carbohydrazide |
| SMILES | CC(C)c1ccc2nc3c(c(C(=O)NN)c2c1)CCCC3 |
| InChI | InChI=1S/C17H21N3O/c1-10(2)11-7-8-15-13(9-11)16(17(21)20-18)12-5-3-4-6-14(12)19-15/h7-10H,3-6,18H2,1-2H3,(H,20,21) |
| InChIKey | UJJAEHUSLPNWNO-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.38 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|