C17H21N3 — CID 82450255
5-propan-2-yl-1,2,3,4-tetrahydroacridine-9-carboximidamide (PubChem CID 82450255) has the molecular formula C17H21N3 and a molecular weight of 267.38 g/mol. Its IUPAC name is 5-propan-2-yl-1,2,3,4-tetrahydroacridine-9-carboximidamide.
| Compound Name | 5-propan-2-yl-1,2,3,4-tetrahydroacridine-9-carboximidamide |
|---|---|
| PubChem CID | 82450255 |
| Molecular Formula | C17H21N3 |
| Molecular Weight | 267.38 g/mol |
| Exact Mass | 267.17 |
| IUPAC Name | 5-propan-2-yl-1,2,3,4-tetrahydroacridine-9-carboximidamide |
| SMILES | [H]/N=C(\N)c1c2c(nc3c(C(C)C)cccc13)CCCC2 |
| InChI | InChI=1S/C17H21N3/c1-10(2)11-7-5-8-13-15(17(18)19)12-6-3-4-9-14(12)20-16(11)13/h5,7-8,10H,3-4,6,9H2,1-2H3,(H3,18,19) |
| InChIKey | NNYKWADAHLGCBY-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 62.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.38 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|