C17H22N2 — CID 82450260
(5-propan-2-yl-1,2,3,4-tetrahydroacridin-9-yl)methanamine (PubChem CID 82450260) has the molecular formula C17H22N2 and a molecular weight of 254.38 g/mol. Its IUPAC name is (5-propan-2-yl-1,2,3,4-tetrahydroacridin-9-yl)methanamine.
| Compound Name | (5-propan-2-yl-1,2,3,4-tetrahydroacridin-9-yl)methanamine |
|---|---|
| PubChem CID | 82450260 |
| Molecular Formula | C17H22N2 |
| Molecular Weight | 254.38 g/mol |
| Exact Mass | 254.18 |
| IUPAC Name | (5-propan-2-yl-1,2,3,4-tetrahydroacridin-9-yl)methanamine |
| SMILES | CC(C)c1cccc2c(CN)c3c(nc12)CCCC3 |
| InChI | InChI=1S/C17H22N2/c1-11(2)12-7-5-8-14-15(10-18)13-6-3-4-9-16(13)19-17(12)14/h5,7-8,11H,3-4,6,9-10,18H2,1-2H3 |
| InChIKey | AFZKTSLHAGYFIR-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.38 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |