C16H19ClN2 — CID 82451207
N-[(5-chloro-1,2,3,4-tetrahydroacridin-9-yl)methyl]ethanamine (PubChem CID 82451207) has the molecular formula C16H19ClN2 and a molecular weight of 274.79 g/mol. Its IUPAC name is N-[(5-chloro-1,2,3,4-tetrahydroacridin-9-yl)methyl]ethanamine.
| Compound Name | N-[(5-chloro-1,2,3,4-tetrahydroacridin-9-yl)methyl]ethanamine |
|---|---|
| PubChem CID | 82451207 |
| Molecular Formula | C16H19ClN2 |
| Molecular Weight | 274.79 g/mol |
| Exact Mass | 274.12 |
| IUPAC Name | N-[(5-chloro-1,2,3,4-tetrahydroacridin-9-yl)methyl]ethanamine |
| SMILES | CCNCc1c2c(nc3c(Cl)cccc13)CCCC2 |
| InChI | InChI=1S/C16H19ClN2/c1-2-18-10-13-11-6-3-4-9-15(11)19-16-12(13)7-5-8-14(16)17/h5,7-8,18H,2-4,6,9-10H2,1H3 |
| InChIKey | RBCHVYPDCDCAHI-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.79 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |