C15H16ClN — CID 82450114
9-(chloromethyl)-5-ethyl-2,3-dihydro-1H-cyclopenta[b]quinoline (PubChem CID 82450114) has the molecular formula C15H16ClN and a molecular weight of 245.75 g/mol. Its IUPAC name is 9-(chloromethyl)-5-ethyl-2,3-dihydro-1H-cyclopenta[b]quinoline.
| Compound Name | 9-(chloromethyl)-5-ethyl-2,3-dihydro-1H-cyclopenta[b]quinoline |
|---|---|
| PubChem CID | 82450114 |
| Molecular Formula | C15H16ClN |
| Molecular Weight | 245.75 g/mol |
| Exact Mass | 245.10 |
| IUPAC Name | 9-(chloromethyl)-5-ethyl-2,3-dihydro-1H-cyclopenta[b]quinoline |
| SMILES | CCc1cccc2c(CCl)c3c(nc12)CCC3 |
| InChI | InChI=1S/C15H16ClN/c1-2-10-5-3-7-12-13(9-16)11-6-4-8-14(11)17-15(10)12/h3,5,7H,2,4,6,8-9H2,1H3 |
| InChIKey | STJJUNNCLVOEQH-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.75 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|