C16H20N2S — CID 82450181
(6-ethyl-2-methyl-3,4-dihydro-1H-benzo[b][1,6]naphthyridin-10-yl)methanethiol (PubChem CID 82450181) has the molecular formula C16H20N2S and a molecular weight of 272.42 g/mol. Its IUPAC name is (6-ethyl-2-methyl-3,4-dihydro-1H-benzo[b][1,6]naphthyridin-10-yl)methanethiol.
| Compound Name | (6-ethyl-2-methyl-3,4-dihydro-1H-benzo[b][1,6]naphthyridin-10-yl)methanethiol |
|---|---|
| PubChem CID | 82450181 |
| Molecular Formula | C16H20N2S |
| Molecular Weight | 272.42 g/mol |
| Exact Mass | 272.13 |
| IUPAC Name | (6-ethyl-2-methyl-3,4-dihydro-1H-benzo[b][1,6]naphthyridin-10-yl)methanethiol |
| SMILES | CCc1cccc2c(CS)c3c(nc12)CCN(C)C3 |
| InChI | InChI=1S/C16H20N2S/c1-3-11-5-4-6-12-14(10-19)13-9-18(2)8-7-15(13)17-16(11)12/h4-6,19H,3,7-10H2,1-2H3 |
| InChIKey | VVOUYQUZFCTSNX-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 16.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.42 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|