C19H27N3 — CID 82450691
N-[(2,6,7-trimethyl-3,4-dihydro-1H-benzo[b][1,6]naphthyridin-10-yl)methyl]propan-1-amine (PubChem CID 82450691) has the molecular formula C19H27N3 and a molecular weight of 297.45 g/mol. Its IUPAC name is N-[(2,6,7-trimethyl-3,4-dihydro-1H-benzo[b][1,6]naphthyridin-10-yl)methyl]propan-1-amine.
| Compound Name | N-[(2,6,7-trimethyl-3,4-dihydro-1H-benzo[b][1,6]naphthyridin-10-yl)methyl]propan-1-amine |
|---|---|
| PubChem CID | 82450691 |
| Molecular Formula | C19H27N3 |
| Molecular Weight | 297.45 g/mol |
| Exact Mass | 297.22 |
| IUPAC Name | N-[(2,6,7-trimethyl-3,4-dihydro-1H-benzo[b][1,6]naphthyridin-10-yl)methyl]propan-1-amine |
| SMILES | CCCNCc1c2c(nc3c(C)c(C)ccc13)CCN(C)C2 |
| InChI | InChI=1S/C19H27N3/c1-5-9-20-11-16-15-7-6-13(2)14(3)19(15)21-18-8-10-22(4)12-17(16)18/h6-7,20H,5,8-12H2,1-4H3 |
| InChIKey | DKWSNPWVGCLQBZ-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.45 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|