C14H16N2S — CID 82449929
(2-methyl-3,4-dihydro-1H-benzo[b][1,6]naphthyridin-10-yl)methanethiol (PubChem CID 82449929) has the molecular formula C14H16N2S and a molecular weight of 244.36 g/mol. Its IUPAC name is (2-methyl-3,4-dihydro-1H-benzo[b][1,6]naphthyridin-10-yl)methanethiol.
| Compound Name | (2-methyl-3,4-dihydro-1H-benzo[b][1,6]naphthyridin-10-yl)methanethiol |
|---|---|
| PubChem CID | 82449929 |
| Molecular Formula | C14H16N2S |
| Molecular Weight | 244.36 g/mol |
| Exact Mass | 244.10 |
| IUPAC Name | (2-methyl-3,4-dihydro-1H-benzo[b][1,6]naphthyridin-10-yl)methanethiol |
| SMILES | CN1CCc2nc3ccccc3c(CS)c2C1 |
| InChI | InChI=1S/C14H16N2S/c1-16-7-6-14-11(8-16)12(9-17)10-4-2-3-5-13(10)15-14/h2-5,17H,6-9H2,1H3 |
| InChIKey | UBFIGGHIZOEZCM-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 16.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.36 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|