C16H19FN2O — CID 82451066
N-[(5-fluoro-2,3-dihydro-1H-cyclopenta[b]quinolin-9-yl)methyl]-2-methoxyethanamine (PubChem CID 82451066) has the molecular formula C16H19FN2O and a molecular weight of 274.34 g/mol. Its IUPAC name is N-[(5-fluoro-2,3-dihydro-1H-cyclopenta[b]quinolin-9-yl)methyl]-2-methoxyethanamine.
| Compound Name | N-[(5-fluoro-2,3-dihydro-1H-cyclopenta[b]quinolin-9-yl)methyl]-2-methoxyethanamine |
|---|---|
| PubChem CID | 82451066 |
| Molecular Formula | C16H19FN2O |
| Molecular Weight | 274.34 g/mol |
| Exact Mass | 274.15 |
| IUPAC Name | N-[(5-fluoro-2,3-dihydro-1H-cyclopenta[b]quinolin-9-yl)methyl]-2-methoxyethanamine |
| SMILES | COCCNCc1c2c(nc3c(F)cccc13)CCC2 |
| InChI | InChI=1S/C16H19FN2O/c1-20-9-8-18-10-13-11-4-3-7-15(11)19-16-12(13)5-2-6-14(16)17/h2,5-6,18H,3-4,7-10H2,1H3 |
| InChIKey | VYNCBBKFHNNALR-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.34 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|