C15H17BrN2 — CID 107578671
7-bromo-6,8-dimethyl-1,2,3,4-tetrahydroacridin-9-amine (PubChem CID 107578671) has the molecular formula C15H17BrN2 and a molecular weight of 305.22 g/mol. Its IUPAC name is 7-bromo-6,8-dimethyl-1,2,3,4-tetrahydroacridin-9-amine.
| Compound Name | 7-bromo-6,8-dimethyl-1,2,3,4-tetrahydroacridin-9-amine |
|---|---|
| PubChem CID | 107578671 |
| Molecular Formula | C15H17BrN2 |
| Molecular Weight | 305.22 g/mol |
| Exact Mass | 304.06 |
| IUPAC Name | 7-bromo-6,8-dimethyl-1,2,3,4-tetrahydroacridin-9-amine |
| SMILES | Cc1cc2nc3c(c(N)c2c(C)c1Br)CCCC3 |
| InChI | InChI=1S/C15H17BrN2/c1-8-7-12-13(9(2)14(8)16)15(17)10-5-3-4-6-11(10)18-12/h7H,3-6H2,1-2H3,(H2,17,18) |
| InChIKey | VIVQNCNFCWHWBQ-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.22 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |