C15H13Cl2FN2O — CID 107578873
7,9-dichloro-N-cyclopropyl-8-fluoro-3,4-dihydro-1H-pyrano[4,3-b]quinolin-10-amine (PubChem CID 107578873) has the molecular formula C15H13Cl2FN2O and a molecular weight of 327.19 g/mol. Its IUPAC name is 7,9-dichloro-N-cyclopropyl-8-fluoro-3,4-dihydro-1H-pyrano[4,3-b]quinolin-10-amine.
| Compound Name | 7,9-dichloro-N-cyclopropyl-8-fluoro-3,4-dihydro-1H-pyrano[4,3-b]quinolin-10-amine |
|---|---|
| PubChem CID | 107578873 |
| Molecular Formula | C15H13Cl2FN2O |
| Molecular Weight | 327.19 g/mol |
| Exact Mass | 326.04 |
| IUPAC Name | 7,9-dichloro-N-cyclopropyl-8-fluoro-3,4-dihydro-1H-pyrano[4,3-b]quinolin-10-amine |
| SMILES | Fc1c(Cl)cc2nc3c(c(NC4CC4)c2c1Cl)COCC3 |
| InChI | InChI=1S/C15H13Cl2FN2O/c16-9-5-11-12(13(17)14(9)18)15(19-7-1-2-7)8-6-21-4-3-10(8)20-11/h5,7H,1-4,6H2,(H,19,20) |
| InChIKey | IZVJRAVUGWTWGH-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.19 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|