C12H7ClF3NO — CID 106471008
10-chloro-6,7,8-trifluoro-3,4-dihydro-1H-pyrano[4,3-b]quinoline (PubChem CID 106471008) has the molecular formula C12H7ClF3NO and a molecular weight of 273.64 g/mol. Its IUPAC name is 10-chloro-6,7,8-trifluoro-3,4-dihydro-1H-pyrano[4,3-b]quinoline.
| Compound Name | 10-chloro-6,7,8-trifluoro-3,4-dihydro-1H-pyrano[4,3-b]quinoline |
|---|---|
| PubChem CID | 106471008 |
| Molecular Formula | C12H7ClF3NO |
| Molecular Weight | 273.64 g/mol |
| Exact Mass | 273.02 |
| IUPAC Name | 10-chloro-6,7,8-trifluoro-3,4-dihydro-1H-pyrano[4,3-b]quinoline |
| SMILES | Fc1cc2c(Cl)c3c(nc2c(F)c1F)CCOC3 |
| InChI | InChI=1S/C12H7ClF3NO/c13-9-5-3-7(14)10(15)11(16)12(5)17-8-1-2-18-4-6(8)9/h3H,1-2,4H2 |
| InChIKey | RXEADBPTSJJGGA-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.64 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|