C16H22N4O — CID 106473776
N,N-diethyl-10-hydrazinyl-3,4-dihydro-1H-pyrano[4,3-b]quinolin-8-amine (PubChem CID 106473776) has the molecular formula C16H22N4O and a molecular weight of 286.38 g/mol. Its IUPAC name is N,N-diethyl-10-hydrazinyl-3,4-dihydro-1H-pyrano[4,3-b]quinolin-8-amine.
| Compound Name | N,N-diethyl-10-hydrazinyl-3,4-dihydro-1H-pyrano[4,3-b]quinolin-8-amine |
|---|---|
| PubChem CID | 106473776 |
| Molecular Formula | C16H22N4O |
| Molecular Weight | 286.38 g/mol |
| Exact Mass | 286.18 |
| IUPAC Name | N,N-diethyl-10-hydrazinyl-3,4-dihydro-1H-pyrano[4,3-b]quinolin-8-amine |
| SMILES | CCN(CC)c1ccc2nc3c(c(NN)c2c1)COCC3 |
| InChI | InChI=1S/C16H22N4O/c1-3-20(4-2)11-5-6-14-12(9-11)16(19-17)13-10-21-8-7-15(13)18-14/h5-6,9H,3-4,7-8,10,17H2,1-2H3,(H,18,19) |
| InChIKey | MSWLNFPWCXGVRW-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 63.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.38 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|