About 7-bromo-6-fluoro-2,3-dihydro-1H-cyclopenta[b]quinoline-9-carboxylic acid
7-bromo-6-fluoro-2,3-dihydro-1H-cyclopenta[b]quinoline-9-carboxylic acid (PubChem CID 61357932) has the molecular formula C13H9BrFNO2
and a molecular weight of 310.12 g/mol. Its IUPAC name is 7-bromo-6-fluoro-2,3-dihydro-1H-cyclopenta[b]quinoline-9-carboxylic acid.
Molecular Properties
| Compound Name | 7-bromo-6-fluoro-2,3-dihydro-1H-cyclopenta[b]quinoline-9-carboxylic acid |
| PubChem CID | 61357932 |
| Molecular Formula | C13H9BrFNO2 |
| Molecular Weight | 310.12 g/mol |
| Exact Mass | 308.98 |
| IUPAC Name | 7-bromo-6-fluoro-2,3-dihydro-1H-cyclopenta[b]quinoline-9-carboxylic acid |
| SMILES | O=C(O)c1c2c(nc3cc(F)c(Br)cc13)CCC2 |
| InChI | InChI=1S/C13H9BrFNO2/c14-8-4-7-11(5-9(8)15)16-10-3-1-2-6(10)12(7)13(17)18/h4-5H,1-3H2,(H,17,18) |
| InChIKey | DCKHAPYJIBCQJX-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.12 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7-bromo-6-fluoro-2,3-dihydro-1H-cyclopenta[b]quinoline-9-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-bromo-6-fluoro-2,3-dihydro-1H-cyclopenta[b]quinoline-9-carboxylic acid?
The IUPAC name of 7-bromo-6-fluoro-2,3-dihydro-1H-cyclopenta[b]quinoline-9-carboxylic acid (CID 61357932) is 7-bromo-6-fluoro-2,3-dihydro-1H-cyclopenta[b]quinoline-9-carboxylic acid.
What is the SMILES notation for 7-bromo-6-fluoro-2,3-dihydro-1H-cyclopenta[b]quinoline-9-carboxylic acid?
The canonical SMILES for 7-bromo-6-fluoro-2,3-dihydro-1H-cyclopenta[b]quinoline-9-carboxylic acid is O=C(O)c1c2c(nc3cc(F)c(Br)cc13)CCC2.
What is the InChIKey of 7-bromo-6-fluoro-2,3-dihydro-1H-cyclopenta[b]quinoline-9-carboxylic acid?
The InChIKey is DCKHAPYJIBCQJX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9BrFNO2/c14-8-4-7-11(5-9(8)15)16-10-3-1-2-6(10)12(7)13(17)18/h4-5H,1-3H2,(H,17,18).
What are the key properties of 7-bromo-6-fluoro-2,3-dihydro-1H-cyclopenta[b]quinoline-9-carboxylic acid?
7-bromo-6-fluoro-2,3-dihydro-1H-cyclopenta[b]quinoline-9-carboxylic acid has a molecular weight of 310.12 g/mol, XLogP of 3.32, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-bromo-6-fluoro-2,3-dihydro-1H-cyclopenta[b]quinoline-9-carboxylic acid is sourced from PubChem (CID 61357932), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).