C26H29N5O4 — CID 75264624
N'-[2-[4-(4-methoxyphenyl)piperazin-1-yl]-2-oxoethoxy]-3-(pyridin-3-ylmethoxy)benzenecarboximidamide (PubChem CID 75264624) has the molecular formula C26H29N5O4 and a molecular weight of 475.55 g/mol. Its IUPAC name is N'-[2-[4-(4-methoxyphenyl)piperazin-1-yl]-2-oxoethoxy]-3-(pyridin-3-ylmethoxy)benzenecarboximidamide.
| Compound Name | N'-[2-[4-(4-methoxyphenyl)piperazin-1-yl]-2-oxoethoxy]-3-(pyridin-3-ylmethoxy)benzenecarboximidamide |
|---|---|
| PubChem CID | 75264624 |
| Molecular Formula | C26H29N5O4 |
| Molecular Weight | 475.55 g/mol |
| Exact Mass | 475.22 |
| IUPAC Name | N'-[2-[4-(4-methoxyphenyl)piperazin-1-yl]-2-oxoethoxy]-3-(pyridin-3-ylmethoxy)benzenecarboximidamide |
| SMILES | COc1ccc(N2CCN(C(=O)CON=C(N)c3cccc(OCc4cccnc4)c3)CC2)cc1 |
| InChI | InChI=1S/C26H29N5O4/c1-33-23-9-7-22(8-10-23)30-12-14-31(15-13-30)25(32)19-35-29-26(27)21-5-2-6-24(16-21)34-18-20-4-3-11-28-17-20/h2-11,16-17H,12-15,18-19H2,1H3,(H2,27,29) |
| InChIKey | XVYGJMGBNARRRV-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 102.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.55 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|