C22H28N4O3 — CID 60609695
N'-[2-(2,6-dimethylpiperidin-1-yl)-2-oxoethoxy]-3-(pyridin-3-ylmethoxy)benzenecarboximidamide (PubChem CID 60609695) has the molecular formula C22H28N4O3 and a molecular weight of 396.49 g/mol. Its IUPAC name is N'-[2-(2,6-dimethylpiperidin-1-yl)-2-oxoethoxy]-3-(pyridin-3-ylmethoxy)benzenecarboximidamide.
| Compound Name | N'-[2-(2,6-dimethylpiperidin-1-yl)-2-oxoethoxy]-3-(pyridin-3-ylmethoxy)benzenecarboximidamide |
|---|---|
| PubChem CID | 60609695 |
| Molecular Formula | C22H28N4O3 |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.22 |
| IUPAC Name | N'-[2-(2,6-dimethylpiperidin-1-yl)-2-oxoethoxy]-3-(pyridin-3-ylmethoxy)benzenecarboximidamide |
| SMILES | CC1CCCC(C)N1C(=O)CO/N=C(/N)c1cccc(OCc2cccnc2)c1 |
| InChI | InChI=1S/C22H28N4O3/c1-16-6-3-7-17(2)26(16)21(27)15-29-25-22(23)19-9-4-10-20(12-19)28-14-18-8-5-11-24-13-18/h4-5,8-13,16-17H,3,6-7,14-15H2,1-2H3,(H2,23,25) |
| InChIKey | VRFIGLUYCPVKSE-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 90.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|