C13H19Cl2NO2 — CID 174693585
[phenyl(piperidin-1-yl)methyl] formate;dihydrochloride (PubChem CID 174693585) has the molecular formula C13H19Cl2NO2 and a molecular weight of 292.21 g/mol. Its IUPAC name is [phenyl(piperidin-1-yl)methyl] formate;dihydrochloride.
| Compound Name | [phenyl(piperidin-1-yl)methyl] formate;dihydrochloride |
|---|---|
| PubChem CID | 174693585 |
| Molecular Formula | C13H19Cl2NO2 |
| Molecular Weight | 292.21 g/mol |
| Exact Mass | 291.08 |
| IUPAC Name | [phenyl(piperidin-1-yl)methyl] formate;dihydrochloride |
| SMILES | Cl.Cl.O=COC(c1ccccc1)N1CCCCC1 |
| InChI | InChI=1S/C13H17NO2.2ClH/c15-11-16-13(12-7-3-1-4-8-12)14-9-5-2-6-10-14;;/h1,3-4,7-8,11,13H,2,5-6,9-10H2;2*1H |
| InChIKey | NSTZOZXZMLHWJD-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.21 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|