C11H13NO3 — CID 174499790
[1,3-oxazolidin-3-yl(phenyl)methyl] formate (PubChem CID 174499790) has the molecular formula C11H13NO3 and a molecular weight of 207.23 g/mol. Its IUPAC name is [1,3-oxazolidin-3-yl(phenyl)methyl] formate.
| Compound Name | [1,3-oxazolidin-3-yl(phenyl)methyl] formate |
|---|---|
| PubChem CID | 174499790 |
| Molecular Formula | C11H13NO3 |
| Molecular Weight | 207.23 g/mol |
| Exact Mass | 207.09 |
| IUPAC Name | [1,3-oxazolidin-3-yl(phenyl)methyl] formate |
| SMILES | O=COC(c1ccccc1)N1CCOC1 |
| InChI | InChI=1S/C11H13NO3/c13-9-15-11(12-6-7-14-8-12)10-4-2-1-3-5-10/h1-5,9,11H,6-8H2 |
| InChIKey | WGZOMPMWLWUKBJ-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.23 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|