[1,3-oxazolidin-3-yl(phenyl)methyl] formate

C11H13NO3 — CID 174499790

IUPAC[1,3-oxazolidin-3-yl(phenyl)methyl] formate
SMILESO=COC(c1ccccc1)N1CCOC1
InChIInChI=1S/C11H13NO3/c13-9-15-11(12-6-7-14-8-12)10-4-2-1-3-5-10/h1-5,9,11H,6-8H2
InChIKeyWGZOMPMWLWUKBJ-UHFFFAOYSA-N
MW207.23 g/mol
LogP1.15
Rot. Bonds4

About [1,3-oxazolidin-3-yl(phenyl)methyl] formate

[1,3-oxazolidin-3-yl(phenyl)methyl] formate (PubChem CID 174499790) has the molecular formula C11H13NO3 and a molecular weight of 207.23 g/mol. Its IUPAC name is [1,3-oxazolidin-3-yl(phenyl)methyl] formate.

Molecular Properties

Compound Name[1,3-oxazolidin-3-yl(phenyl)methyl] formate
PubChem CID174499790
Molecular FormulaC11H13NO3
Molecular Weight207.23 g/mol
Exact Mass207.09
IUPAC Name[1,3-oxazolidin-3-yl(phenyl)methyl] formate
SMILESO=COC(c1ccccc1)N1CCOC1
InChIInChI=1S/C11H13NO3/c13-9-15-11(12-6-7-14-8-12)10-4-2-1-3-5-10/h1-5,9,11H,6-8H2
InChIKeyWGZOMPMWLWUKBJ-UHFFFAOYSA-N
XLogP1.15
TPSA38.77 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500207.23
LogP ≤ 51.15
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'aldehyde', 'substructure': 'N/A'}

Analyze [1,3-oxazolidin-3-yl(phenyl)methyl] formate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of [1,3-oxazolidin-3-yl(phenyl)methyl] formate?
The IUPAC name of [1,3-oxazolidin-3-yl(phenyl)methyl] formate (CID 174499790) is [1,3-oxazolidin-3-yl(phenyl)methyl] formate.
What is the SMILES notation for [1,3-oxazolidin-3-yl(phenyl)methyl] formate?
The canonical SMILES for [1,3-oxazolidin-3-yl(phenyl)methyl] formate is O=COC(c1ccccc1)N1CCOC1.
What is the InChIKey of [1,3-oxazolidin-3-yl(phenyl)methyl] formate?
The InChIKey is WGZOMPMWLWUKBJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13NO3/c13-9-15-11(12-6-7-14-8-12)10-4-2-1-3-5-10/h1-5,9,11H,6-8H2.
What are the key properties of [1,3-oxazolidin-3-yl(phenyl)methyl] formate?
[1,3-oxazolidin-3-yl(phenyl)methyl] formate has a molecular weight of 207.23 g/mol, XLogP of 1.15, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [1,3-oxazolidin-3-yl(phenyl)methyl] formate is sourced from PubChem (CID 174499790), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).