C21H27N3O4S — CID 174555228
tert-butyl 4-amino-3-[1-[formyloxy(phenyl)methyl]piperidin-3-yl]-1,2-thiazole-5-carboxylate (PubChem CID 174555228) has the molecular formula C21H27N3O4S and a molecular weight of 417.53 g/mol. Its IUPAC name is tert-butyl 4-amino-3-[1-[formyloxy(phenyl)methyl]piperidin-3-yl]-1,2-thiazole-5-carboxylate.
| Compound Name | tert-butyl 4-amino-3-[1-[formyloxy(phenyl)methyl]piperidin-3-yl]-1,2-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 174555228 |
| Molecular Formula | C21H27N3O4S |
| Molecular Weight | 417.53 g/mol |
| Exact Mass | 417.17 |
| IUPAC Name | tert-butyl 4-amino-3-[1-[formyloxy(phenyl)methyl]piperidin-3-yl]-1,2-thiazole-5-carboxylate |
| SMILES | CC(C)(C)OC(=O)c1snc(C2CCCN(C(OC=O)c3ccccc3)C2)c1N |
| InChI | InChI=1S/C21H27N3O4S/c1-21(2,3)28-20(26)18-16(22)17(23-29-18)15-10-7-11-24(12-15)19(27-13-25)14-8-5-4-6-9-14/h4-6,8-9,13,15,19H,7,10-12,22H2,1-3H3 |
| InChIKey | UTYSEOKGDMQJGV-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 94.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.53 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|