About carbamoylurea;styrene
carbamoylurea;styrene (PubChem CID 175233762) has the molecular formula C10H13N3O2
and a molecular weight of 207.23 g/mol. Its IUPAC name is carbamoylurea;styrene.
Molecular Properties
| Compound Name | carbamoylurea;styrene |
| PubChem CID | 175233762 |
| Molecular Formula | C10H13N3O2 |
| Molecular Weight | 207.23 g/mol |
| Exact Mass | 207.10 |
| IUPAC Name | carbamoylurea;styrene |
| SMILES | C=Cc1ccccc1.NC(=O)NC(N)=O |
| InChI | InChI=1S/C8H8.C2H5N3O2/c1-2-8-6-4-3-5-7-8;3-1(6)5-2(4)7/h2-7H,1H2;(H5,3,4,5,6,7) |
| InChIKey | HMHVLHSVVWLSQE-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 98.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.23 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze carbamoylurea;styrene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbamoylurea;styrene?
The IUPAC name of carbamoylurea;styrene (CID 175233762) is carbamoylurea;styrene.
What is the SMILES notation for carbamoylurea;styrene?
The canonical SMILES for carbamoylurea;styrene is C=Cc1ccccc1.NC(=O)NC(N)=O.
What is the InChIKey of carbamoylurea;styrene?
The InChIKey is HMHVLHSVVWLSQE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8.C2H5N3O2/c1-2-8-6-4-3-5-7-8;3-1(6)5-2(4)7/h2-7H,1H2;(H5,3,4,5,6,7).
What are the key properties of carbamoylurea;styrene?
carbamoylurea;styrene has a molecular weight of 207.23 g/mol, XLogP of 1.06, 1 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for carbamoylurea;styrene is sourced from PubChem (CID 175233762), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).