About N-[(3R,4R)-3-hydroxypiperidin-4-yl]-4-naphthalen-1-yl-4-oxobutanamide
N-[(3R,4R)-3-hydroxypiperidin-4-yl]-4-naphthalen-1-yl-4-oxobutanamide (PubChem CID 70719980) has the molecular formula C19H22N2O3
and a molecular weight of 326.40 g/mol. Its IUPAC name is N-[(3R,4R)-3-hydroxypiperidin-4-yl]-4-naphthalen-1-yl-4-oxobutanamide.
Molecular Properties
| Compound Name | N-[(3R,4R)-3-hydroxypiperidin-4-yl]-4-naphthalen-1-yl-4-oxobutanamide |
| PubChem CID | 70719980 |
| Molecular Formula | C19H22N2O3 |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.16 |
| IUPAC Name | N-[(3R,4R)-3-hydroxypiperidin-4-yl]-4-naphthalen-1-yl-4-oxobutanamide |
| SMILES | O=C(CCC(=O)c1cccc2ccccc12)N[C@@H]1CCNC[C@H]1O |
| InChI | InChI=1S/C19H22N2O3/c22-17(15-7-3-5-13-4-1-2-6-14(13)15)8-9-19(24)21-16-10-11-20-12-18(16)23/h1-7,16,18,20,23H,8-12H2,(H,21,24)/t16-,18-/m1/s1 |
| InChIKey | HQXVCVCVZUORCU-SJLPKXTDSA-N |
| XLogP | 1.64 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[(3R,4R)-3-hydroxypiperidin-4-yl]-4-naphthalen-1-yl-4-oxobutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3R,4R)-3-hydroxypiperidin-4-yl]-4-naphthalen-1-yl-4-oxobutanamide?
The IUPAC name of N-[(3R,4R)-3-hydroxypiperidin-4-yl]-4-naphthalen-1-yl-4-oxobutanamide (CID 70719980) is N-[(3R,4R)-3-hydroxypiperidin-4-yl]-4-naphthalen-1-yl-4-oxobutanamide.
What is the SMILES notation for N-[(3R,4R)-3-hydroxypiperidin-4-yl]-4-naphthalen-1-yl-4-oxobutanamide?
The canonical SMILES for N-[(3R,4R)-3-hydroxypiperidin-4-yl]-4-naphthalen-1-yl-4-oxobutanamide is O=C(CCC(=O)c1cccc2ccccc12)N[C@@H]1CCNC[C@H]1O.
What is the InChIKey of N-[(3R,4R)-3-hydroxypiperidin-4-yl]-4-naphthalen-1-yl-4-oxobutanamide?
The InChIKey is HQXVCVCVZUORCU-SJLPKXTDSA-N. The full InChI is InChI=1S/C19H22N2O3/c22-17(15-7-3-5-13-4-1-2-6-14(13)15)8-9-19(24)21-16-10-11-20-12-18(16)23/h1-7,16,18,20,23H,8-12H2,(H,21,24)/t16-,18-/m1/s1.
What are the key properties of N-[(3R,4R)-3-hydroxypiperidin-4-yl]-4-naphthalen-1-yl-4-oxobutanamide?
N-[(3R,4R)-3-hydroxypiperidin-4-yl]-4-naphthalen-1-yl-4-oxobutanamide has a molecular weight of 326.40 g/mol, XLogP of 1.64, 5 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3R,4R)-3-hydroxypiperidin-4-yl]-4-naphthalen-1-yl-4-oxobutanamide is sourced from PubChem (CID 70719980), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).