C21H23ClN2O3S — CID 133179222
5-[benzenesulfonyl(methyl)amino]-N-[(2R)-2-bicyclo[2.2.1]heptanyl]-2-chlorobenzamide (PubChem CID 133179222) has the molecular formula C21H23ClN2O3S and a molecular weight of 418.95 g/mol. Its IUPAC name is 5-[benzenesulfonyl(methyl)amino]-N-[(2R)-2-bicyclo[2.2.1]heptanyl]-2-chlorobenzamide.
| Compound Name | 5-[benzenesulfonyl(methyl)amino]-N-[(2R)-2-bicyclo[2.2.1]heptanyl]-2-chlorobenzamide |
|---|---|
| PubChem CID | 133179222 |
| Molecular Formula | C21H23ClN2O3S |
| Molecular Weight | 418.95 g/mol |
| Exact Mass | 418.11 |
| IUPAC Name | 5-[benzenesulfonyl(methyl)amino]-N-[(2R)-2-bicyclo[2.2.1]heptanyl]-2-chlorobenzamide |
| SMILES | CN(c1ccc(Cl)c(C(=O)N[C@@H]2CC3CCC2C3)c1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C21H23ClN2O3S/c1-24(28(26,27)17-5-3-2-4-6-17)16-9-10-19(22)18(13-16)21(25)23-20-12-14-7-8-15(20)11-14/h2-6,9-10,13-15,20H,7-8,11-12H2,1H3,(H,23,25)/t14?,15?,20-/m1/s1 |
| InChIKey | AKTOAFSBFFOYIL-NODKNVJMSA-N |
| XLogP | 4.08 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.95 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |