C20H20Cl2N2O3S — CID 133203412
N-[(2R)-2-bicyclo[2.2.1]heptanyl]-2-chloro-5-[(4-chlorophenyl)sulfonylamino]benzamide (PubChem CID 133203412) has the molecular formula C20H20Cl2N2O3S and a molecular weight of 439.36 g/mol. Its IUPAC name is N-[(2R)-2-bicyclo[2.2.1]heptanyl]-2-chloro-5-[(4-chlorophenyl)sulfonylamino]benzamide.
| Compound Name | N-[(2R)-2-bicyclo[2.2.1]heptanyl]-2-chloro-5-[(4-chlorophenyl)sulfonylamino]benzamide |
|---|---|
| PubChem CID | 133203412 |
| Molecular Formula | C20H20Cl2N2O3S |
| Molecular Weight | 439.36 g/mol |
| Exact Mass | 438.06 |
| IUPAC Name | N-[(2R)-2-bicyclo[2.2.1]heptanyl]-2-chloro-5-[(4-chlorophenyl)sulfonylamino]benzamide |
| SMILES | O=C(N[C@@H]1CC2CCC1C2)c1cc(NS(=O)(=O)c2ccc(Cl)cc2)ccc1Cl |
| InChI | InChI=1S/C20H20Cl2N2O3S/c21-14-3-6-16(7-4-14)28(26,27)24-15-5-8-18(22)17(11-15)20(25)23-19-10-12-1-2-13(19)9-12/h3-8,11-13,19,24H,1-2,9-10H2,(H,23,25)/t12?,13?,19-/m1/s1 |
| InChIKey | QPZMZDWMJKSCGH-PNQRNNEWSA-N |
| XLogP | 4.71 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.36 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |