C17H23ClN2S — CID 2385774
(1R,5S)-N-(2-chlorophenyl)-1,3,3-trimethyl-6-azabicyclo[3.2.1]octane-6-carbothioamide (PubChem CID 2385774) has the molecular formula C17H23ClN2S and a molecular weight of 322.90 g/mol. Its IUPAC name is (1R,5S)-N-(2-chlorophenyl)-1,3,3-trimethyl-6-azabicyclo[3.2.1]octane-6-carbothioamide.
| Compound Name | (1R,5S)-N-(2-chlorophenyl)-1,3,3-trimethyl-6-azabicyclo[3.2.1]octane-6-carbothioamide |
|---|---|
| PubChem CID | 2385774 |
| Molecular Formula | C17H23ClN2S |
| Molecular Weight | 322.90 g/mol |
| Exact Mass | 322.13 |
| IUPAC Name | (1R,5S)-N-(2-chlorophenyl)-1,3,3-trimethyl-6-azabicyclo[3.2.1]octane-6-carbothioamide |
| SMILES | CC1(C)C[C@H]2C[C@](C)(CN2C(=S)Nc2ccccc2Cl)C1 |
| InChI | InChI=1S/C17H23ClN2S/c1-16(2)8-12-9-17(3,10-16)11-20(12)15(21)19-14-7-5-4-6-13(14)18/h4-7,12H,8-11H2,1-3H3,(H,19,21)/t12-,17-/m0/s1 |
| InChIKey | YJVVPQABIMYVGA-SJCJKPOMSA-N |
| XLogP | 4.94 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.90 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|