C13H15N2O3S- — CID 7393321
(2S,4S)-1-(benzylcarbamothioyl)-4-hydroxypyrrolidine-2-carboxylate (PubChem CID 7393321) has the molecular formula C13H15N2O3S- and a molecular weight of 279.34 g/mol. Its IUPAC name is (2S,4S)-1-(benzylcarbamothioyl)-4-hydroxypyrrolidine-2-carboxylate.
| Compound Name | (2S,4S)-1-(benzylcarbamothioyl)-4-hydroxypyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 7393321 |
| Molecular Formula | C13H15N2O3S- |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.08 |
| IUPAC Name | (2S,4S)-1-(benzylcarbamothioyl)-4-hydroxypyrrolidine-2-carboxylate |
| SMILES | O=C([O-])[C@@H]1C[C@H](O)CN1C(=S)NCc1ccccc1 |
| InChI | InChI=1S/C13H16N2O3S/c16-10-6-11(12(17)18)15(8-10)13(19)14-7-9-4-2-1-3-5-9/h1-5,10-11,16H,6-8H2,(H,14,19)(H,17,18)/p-1/t10-,11-/m0/s1 |
| InChIKey | RCYFQLYRPLPVHD-QWRGUYRKSA-M |
| XLogP | -0.75 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|